C59H48N2Si2 — CID 59220400
5-[6-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)-9-(4-methylphenyl)-10-naphthalen-2-ylanthracen-2-yl]-10,10-dimethylbenzo[b][1,4]benzazasiline (PubChem CID 59220400) has the molecular formula C59H48N2Si2 and a molecular weight of 841.22 g/mol. Its IUPAC name is 5-[6-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)-9-(4-methylphenyl)-10-naphthalen-2-ylanthracen-2-yl]-10,10-dimethylbenzo[b][1,4]benzazasiline.
| Compound Name | 5-[6-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)-9-(4-methylphenyl)-10-naphthalen-2-ylanthracen-2-yl]-10,10-dimethylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 59220400 |
| Molecular Formula | C59H48N2Si2 |
| Molecular Weight | 841.22 g/mol |
| Exact Mass | 840.34 |
| IUPAC Name | 5-[6-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)-9-(4-methylphenyl)-10-naphthalen-2-ylanthracen-2-yl]-10,10-dimethylbenzo[b][1,4]benzazasiline |
| SMILES | Cc1ccc(-c2c3ccc(N4c5ccccc5[Si](C)(C)c5ccccc54)cc3c(-c3ccc4ccccc4c3)c3ccc(N4c5ccccc5[Si](C)(C)c5ccccc54)cc23)cc1 |
| InChI | InChI=1S/C59H48N2Si2/c1-39-26-28-41(29-27-39)58-46-34-32-45(61-52-20-10-14-24-56(52)63(4,5)57-25-15-11-21-53(57)61)38-49(46)59(43-31-30-40-16-6-7-17-42(40)36-43)47-35-33-44(37-48(47)58)60-50-18-8-12-22-54(50)62(2,3)55-23-13-9-19-51(55)60/h6-38H,1-5H3 |
| InChIKey | BWHSLUYMEBQFHQ-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.22 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|