C48H48N2Si2 — CID 59220657
[2,6-bis(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-10-trimethylsilylanthracen-9-yl]-trimethylsilane (PubChem CID 59220657) has the molecular formula C48H48N2Si2 and a molecular weight of 709.10 g/mol. Its IUPAC name is [2,6-bis(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-10-trimethylsilylanthracen-9-yl]-trimethylsilane.
| Compound Name | [2,6-bis(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-10-trimethylsilylanthracen-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 59220657 |
| Molecular Formula | C48H48N2Si2 |
| Molecular Weight | 709.10 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | [2,6-bis(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-10-trimethylsilylanthracen-9-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1c2ccc(N3c4ccccc4CCc4ccccc43)cc2c([Si](C)(C)C)c2ccc(N3c4ccccc4CCc4ccccc43)cc12 |
| InChI | InChI=1S/C48H48N2Si2/c1-51(2,3)47-39-29-27-38(50-45-21-13-9-17-35(45)25-26-36-18-10-14-22-46(36)50)32-42(39)48(52(4,5)6)40-30-28-37(31-41(40)47)49-43-19-11-7-15-33(43)23-24-34-16-8-12-20-44(34)49/h7-22,27-32H,23-26H2,1-6H3 |
| InChIKey | PHZAJEZAVFXSBN-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.10 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|