C34H28O — CID 59221438
3,7-bis[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]dibenzofuran (PubChem CID 59221438) has the molecular formula C34H28O and a molecular weight of 452.60 g/mol. Its IUPAC name is 3,7-bis[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]dibenzofuran.
| Compound Name | 3,7-bis[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]dibenzofuran |
|---|---|
| PubChem CID | 59221438 |
| Molecular Formula | C34H28O |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3,7-bis[(1E,3E)-4-(4-methylphenyl)buta-1,3-dienyl]dibenzofuran |
| SMILES | Cc1ccc(/C=C/C=C/c2ccc3c(c2)oc2cc(/C=C/C=C/c4ccc(C)cc4)ccc23)cc1 |
| InChI | InChI=1S/C34H28O/c1-25-11-15-27(16-12-25)7-3-5-9-29-19-21-31-32-22-20-30(24-34(32)35-33(31)23-29)10-6-4-8-28-17-13-26(2)14-18-28/h3-24H,1-2H3/b7-3+,8-4+,9-5+,10-6+ |
| InChIKey | DFEFJLUPJLWZLO-JMFUVXGRSA-N |
| XLogP | 9.66 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|