C17H18N2Si — CID 59221871
trimethyl-(13-methyl-3,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2(7),3,5,9,11(15),12-heptaen-10-yl)silane (PubChem CID 59221871) has the molecular formula C17H18N2Si and a molecular weight of 278.43 g/mol. Its IUPAC name is trimethyl-(13-methyl-3,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2(7),3,5,9,11(15),12-heptaen-10-yl)silane.
| Compound Name | trimethyl-(13-methyl-3,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2(7),3,5,9,11(15),12-heptaen-10-yl)silane |
|---|---|
| PubChem CID | 59221871 |
| Molecular Formula | C17H18N2Si |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | trimethyl-(13-methyl-3,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2(7),3,5,9,11(15),12-heptaen-10-yl)silane |
| SMILES | Cc1cc2c([Si](C)(C)C)cn3c4cccnc4c(c1)c23 |
| InChI | InChI=1S/C17H18N2Si/c1-11-8-12-15(20(2,3)4)10-19-14-6-5-7-18-16(14)13(9-11)17(12)19/h5-10H,1-4H3 |
| InChIKey | URCRLMKDVUWQPO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|