C49H37NSSi2 — CID 59221889
(5-methyl-10-triphenylsilyl-9-thia-1-azatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8(14),10,12-hexaen-12-yl)-triphenylsilane (PubChem CID 59221889) has the molecular formula C49H37NSSi2 and a molecular weight of 728.08 g/mol. Its IUPAC name is (5-methyl-10-triphenylsilyl-9-thia-1-azatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8(14),10,12-hexaen-12-yl)-triphenylsilane.
| Compound Name | (5-methyl-10-triphenylsilyl-9-thia-1-azatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8(14),10,12-hexaen-12-yl)-triphenylsilane |
|---|---|
| PubChem CID | 59221889 |
| Molecular Formula | C49H37NSSi2 |
| Molecular Weight | 728.08 g/mol |
| Exact Mass | 727.22 |
| IUPAC Name | (5-methyl-10-triphenylsilyl-9-thia-1-azatetracyclo[6.5.1.02,7.011,14]tetradeca-2(7),3,5,8(14),10,12-hexaen-12-yl)-triphenylsilane |
| SMILES | Cc1ccc2c(c1)c1sc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c3c([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cn2c31 |
| InChI | InChI=1S/C49H37NSSi2/c1-36-32-33-44-43(34-36)48-47-46(49(51-48)53(40-26-14-5-15-27-40,41-28-16-6-17-29-41)42-30-18-7-19-31-42)45(35-50(44)47)52(37-20-8-2-9-21-37,38-22-10-3-11-23-38)39-24-12-4-13-25-39/h2-35H,1H3 |
| InChIKey | ABLDSFRQGQGSHE-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.08 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|