C9H16N2 — CID 59222469
(2E,4E,6E)-nona-2,4,6-triene-2,8-diamine (PubChem CID 59222469) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,4E,6E)-nona-2,4,6-triene-2,8-diamine.
| Compound Name | (2E,4E,6E)-nona-2,4,6-triene-2,8-diamine |
|---|---|
| PubChem CID | 59222469 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (2E,4E,6E)-nona-2,4,6-triene-2,8-diamine |
| SMILES | C/C(N)=C\C=C\C=C\C(C)N |
| InChI | InChI=1S/C9H16N2/c1-8(10)6-4-3-5-7-9(2)11/h3-8H,10-11H2,1-2H3/b5-3+,6-4+,9-7+ |
| InChIKey | SOKLERZQSVWYSY-GJOOXVBWSA-N |
| XLogP | 1.31 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|