About (E)-non-2-ene-2,8-diamine
(E)-non-2-ene-2,8-diamine (PubChem CID 59222473) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is (E)-non-2-ene-2,8-diamine.
Molecular Properties
| Compound Name | (E)-non-2-ene-2,8-diamine |
| PubChem CID | 59222473 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | (E)-non-2-ene-2,8-diamine |
| SMILES | C/C(N)=C\CCCCC(C)N |
| InChI | InChI=1S/C9H20N2/c1-8(10)6-4-3-5-7-9(2)11/h6,9H,3-5,7,10-11H2,1-2H3/b8-6+ |
| InChIKey | FZCMXVZTYBSLCF-SOFGYWHQSA-N |
| XLogP | 1.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-non-2-ene-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-non-2-ene-2,8-diamine?
The IUPAC name of (E)-non-2-ene-2,8-diamine (CID 59222473) is (E)-non-2-ene-2,8-diamine.
What is the SMILES notation for (E)-non-2-ene-2,8-diamine?
The canonical SMILES for (E)-non-2-ene-2,8-diamine is C/C(N)=C\CCCCC(C)N.
What is the InChIKey of (E)-non-2-ene-2,8-diamine?
The InChIKey is FZCMXVZTYBSLCF-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H20N2/c1-8(10)6-4-3-5-7-9(2)11/h6,9H,3-5,7,10-11H2,1-2H3/b8-6+.
What are the key properties of (E)-non-2-ene-2,8-diamine?
(E)-non-2-ene-2,8-diamine has a molecular weight of 156.27 g/mol, XLogP of 1.76, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-non-2-ene-2,8-diamine is sourced from PubChem (CID 59222473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).