C37H26F6O12 — CID 59222492
4-[2-[3-carboxy-4-[(4-methoxycarbonylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methoxycarbonylphenyl)methoxycarbonyl]benzoic acid (PubChem CID 59222492) has the molecular formula C37H26F6O12 and a molecular weight of 776.59 g/mol. Its IUPAC name is 4-[2-[3-carboxy-4-[(4-methoxycarbonylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methoxycarbonylphenyl)methoxycarbonyl]benzoic acid.
| Compound Name | 4-[2-[3-carboxy-4-[(4-methoxycarbonylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methoxycarbonylphenyl)methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 59222492 |
| Molecular Formula | C37H26F6O12 |
| Molecular Weight | 776.59 g/mol |
| Exact Mass | 776.13 |
| IUPAC Name | 4-[2-[3-carboxy-4-[(4-methoxycarbonylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methoxycarbonylphenyl)methoxycarbonyl]benzoic acid |
| SMILES | COC(=O)c1ccc(COC(=O)c2ccc(C(c3ccc(C(=O)O)c(C(=O)OCc4ccc(C(=O)OC)cc4)c3)(C(F)(F)F)C(F)(F)F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C37H26F6O12/c1-52-31(48)21-7-3-19(4-8-21)17-54-33(50)26-14-12-23(15-27(26)30(46)47)35(36(38,39)40,37(41,42)43)24-11-13-25(29(44)45)28(16-24)34(51)55-18-20-5-9-22(10-6-20)32(49)53-2/h3-16H,17-18H2,1-2H3,(H,44,45)(H,46,47) |
| InChIKey | SYWGTMYSTXSBGB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|