C41H38F6O8 — CID 59222494
2-[(4-tert-butylphenyl)methoxycarbonyl]-4-[2-[4-[(4-tert-butylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid (PubChem CID 59222494) has the molecular formula C41H38F6O8 and a molecular weight of 772.74 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methoxycarbonyl]-4-[2-[4-[(4-tert-butylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid.
| Compound Name | 2-[(4-tert-butylphenyl)methoxycarbonyl]-4-[2-[4-[(4-tert-butylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 59222494 |
| Molecular Formula | C41H38F6O8 |
| Molecular Weight | 772.74 g/mol |
| Exact Mass | 772.25 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methoxycarbonyl]-4-[2-[4-[(4-tert-butylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(COC(=O)c2ccc(C(c3ccc(C(=O)O)c(C(=O)OCc4ccc(C(C)(C)C)cc4)c3)(C(F)(F)F)C(F)(F)F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C41H38F6O8/c1-37(2,3)25-11-7-23(8-12-25)21-54-35(52)30-18-16-27(19-31(30)34(50)51)39(40(42,43)44,41(45,46)47)28-15-17-29(33(48)49)32(20-28)36(53)55-22-24-9-13-26(14-10-24)38(4,5)6/h7-20H,21-22H2,1-6H3,(H,48,49)(H,50,51) |
| InChIKey | GVAXQPYNJITSIU-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.74 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |