C35H26F6O8 — CID 59222495
4-[2-[3-carboxy-4-[(4-methylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methylphenyl)methoxycarbonyl]benzoic acid (PubChem CID 59222495) has the molecular formula C35H26F6O8 and a molecular weight of 688.57 g/mol. Its IUPAC name is 4-[2-[3-carboxy-4-[(4-methylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methylphenyl)methoxycarbonyl]benzoic acid.
| Compound Name | 4-[2-[3-carboxy-4-[(4-methylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methylphenyl)methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 59222495 |
| Molecular Formula | C35H26F6O8 |
| Molecular Weight | 688.57 g/mol |
| Exact Mass | 688.15 |
| IUPAC Name | 4-[2-[3-carboxy-4-[(4-methylphenyl)methoxycarbonyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-[(4-methylphenyl)methoxycarbonyl]benzoic acid |
| SMILES | Cc1ccc(COC(=O)c2ccc(C(c3ccc(C(=O)O)c(C(=O)OCc4ccc(C)cc4)c3)(C(F)(F)F)C(F)(F)F)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C35H26F6O8/c1-19-3-7-21(8-4-19)17-48-31(46)26-14-12-23(15-27(26)30(44)45)33(34(36,37)38,35(39,40)41)24-11-13-25(29(42)43)28(16-24)32(47)49-18-22-9-5-20(2)6-10-22/h3-16H,17-18H2,1-2H3,(H,42,43)(H,44,45) |
| InChIKey | POAMGEZRVWBZHR-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.57 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |