C29H21BrF6O8 — CID 59222501
4-[2-[4-[(3-bromo-4-ethylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxycarbonylbenzoic acid (PubChem CID 59222501) has the molecular formula C29H21BrF6O8 and a molecular weight of 691.37 g/mol. Its IUPAC name is 4-[2-[4-[(3-bromo-4-ethylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxycarbonylbenzoic acid.
| Compound Name | 4-[2-[4-[(3-bromo-4-ethylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 59222501 |
| Molecular Formula | C29H21BrF6O8 |
| Molecular Weight | 691.37 g/mol |
| Exact Mass | 690.03 |
| IUPAC Name | 4-[2-[4-[(3-bromo-4-ethylphenyl)methoxycarbonyl]-3-carboxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxycarbonylbenzoic acid |
| SMILES | CCc1ccc(COC(=O)c2ccc(C(c3ccc(C(=O)O)c(C(=O)OC)c3)(C(F)(F)F)C(F)(F)F)cc2C(=O)O)cc1Br |
| InChI | InChI=1S/C29H21BrF6O8/c1-3-15-5-4-14(10-22(15)30)13-44-26(42)19-9-7-16(11-20(19)24(39)40)27(28(31,32)33,29(34,35)36)17-6-8-18(23(37)38)21(12-17)25(41)43-2/h4-12H,3,13H2,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | FQCYVRMRLQBWLI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.37 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |