C18H13F5O7S — CID 59222704
1,1,3,3,3-pentafluoro-2-[6-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 59222704) has the molecular formula C18H13F5O7S and a molecular weight of 468.35 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[6-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[6-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59222704 |
| Molecular Formula | C18H13F5O7S |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[6-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)Oc1ccc2cc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C18H13F5O7S/c1-9(2)14(24)29-13-6-5-10-7-12(4-3-11(10)8-13)15(25)30-16(17(19,20)21)18(22,23)31(26,27)28/h3-8,16H,1H2,2H3,(H,26,27,28) |
| InChIKey | CBYCVVVZTCQMRY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|