C14H16F5O7S- — CID 59222731
1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxypropane-1-sulfonate (PubChem CID 59222731) has the molecular formula C14H16F5O7S- and a molecular weight of 423.33 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59222731 |
| Molecular Formula | C14H16F5O7S- |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[4-(2-methylprop-2-enoyloxy)cyclohexanecarbonyl]oxypropane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-])CC1 |
| InChI | InChI=1S/C14H17F5O7S/c1-7(2)10(20)25-9-5-3-8(4-6-9)11(21)26-12(13(15,16)17)14(18,19)27(22,23)24/h8-9,12H,1,3-6H2,2H3,(H,22,23,24)/p-1 |
| InChIKey | SVKAZMKUXRXVCT-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|