C18H12F5O7S- — CID 59222739
1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonate (PubChem CID 59222739) has the molecular formula C18H12F5O7S- and a molecular weight of 467.34 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59222739 |
| Molecular Formula | C18H12F5O7S- |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-[3-(2-methylprop-2-enoyloxy)naphthalene-2-carbonyl]oxypropane-1-sulfonate |
| SMILES | C=C(C)C(=O)Oc1cc2ccccc2cc1C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C18H13F5O7S/c1-9(2)14(24)29-13-8-11-6-4-3-5-10(11)7-12(13)15(25)30-16(17(19,20)21)18(22,23)31(26,27)28/h3-8,16H,1H2,2H3,(H,26,27,28)/p-1 |
| InChIKey | FGUQPWBFAVSUEQ-UHFFFAOYSA-M |
| XLogP | 3.55 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|