C17H10F5O7S- — CID 59222781
1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxynaphthalene-2-carbonyl)oxypropane-1-sulfonate (PubChem CID 59222781) has the molecular formula C17H10F5O7S- and a molecular weight of 453.32 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxynaphthalene-2-carbonyl)oxypropane-1-sulfonate.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxynaphthalene-2-carbonyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59222781 |
| Molecular Formula | C17H10F5O7S- |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxynaphthalene-2-carbonyl)oxypropane-1-sulfonate |
| SMILES | C=CC(=O)Oc1cc2ccccc2cc1C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C17H11F5O7S/c1-2-13(23)28-12-8-10-6-4-3-5-9(10)7-11(12)14(24)29-15(16(18,19)20)17(21,22)30(25,26)27/h2-8,15H,1H2,(H,25,26,27)/p-1 |
| InChIKey | SWJRZKLTDJKPHG-UHFFFAOYSA-M |
| XLogP | 3.16 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|