C13H9F5O7S — CID 59222794
1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonic acid (PubChem CID 59222794) has the molecular formula C13H9F5O7S and a molecular weight of 404.27 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 59222794 |
| Molecular Formula | C13H9F5O7S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(3-prop-2-enoyloxybenzoyl)oxypropane-1-sulfonic acid |
| SMILES | C=CC(=O)Oc1cccc(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C13H9F5O7S/c1-2-9(19)24-8-5-3-4-7(6-8)10(20)25-11(12(14,15)16)13(17,18)26(21,22)23/h2-6,11H,1H2,(H,21,22,23) |
| InChIKey | HGCFMZONTMHBSS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|