C22H13ClF6N4O — CID 59223013
N-[2-[3-chloro-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine (PubChem CID 59223013) has the molecular formula C22H13ClF6N4O and a molecular weight of 498.81 g/mol. Its IUPAC name is N-[2-[3-chloro-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine.
| Compound Name | N-[2-[3-chloro-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 59223013 |
| Molecular Formula | C22H13ClF6N4O |
| Molecular Weight | 498.81 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-[2-[3-chloro-4-[[4-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethyl]-5,6,8-trifluoroquinazolin-4-amine |
| SMILES | Fc1cc(F)c2ncnc(NCCc3ccc(Oc4cc(C(F)(F)F)ccn4)c(Cl)c3)c2c1F |
| InChI | InChI=1S/C22H13ClF6N4O/c23-13-7-11(1-2-16(13)34-17-8-12(4-6-30-17)22(27,28)29)3-5-31-21-18-19(26)14(24)9-15(25)20(18)32-10-33-21/h1-2,4,6-10H,3,5H2,(H,31,32,33) |
| InChIKey | WVDVIJAKNAQRBA-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|