C17H14F3N3O — CID 59223015
5,8-difluoro-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]quinazolin-4-amine (PubChem CID 59223015) has the molecular formula C17H14F3N3O and a molecular weight of 333.31 g/mol. Its IUPAC name is 5,8-difluoro-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]quinazolin-4-amine.
| Compound Name | 5,8-difluoro-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 59223015 |
| Molecular Formula | C17H14F3N3O |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5,8-difluoro-N-[2-(2-fluoro-4-methoxyphenyl)ethyl]quinazolin-4-amine |
| SMILES | COc1ccc(CCNc2ncnc3c(F)ccc(F)c23)c(F)c1 |
| InChI | InChI=1S/C17H14F3N3O/c1-24-11-3-2-10(14(20)8-11)6-7-21-17-15-12(18)4-5-13(19)16(15)22-9-23-17/h2-5,8-9H,6-7H2,1H3,(H,21,22,23) |
| InChIKey | PUJIOTNYBQDPNC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |