C16H23NO7 — CID 59223074
[(1R,5R,6S)-5,6-diacetyloxy-3-(propylcarbamoyl)cyclohex-3-en-1-yl] acetate (PubChem CID 59223074) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is [(1R,5R,6S)-5,6-diacetyloxy-3-(propylcarbamoyl)cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,5R,6S)-5,6-diacetyloxy-3-(propylcarbamoyl)cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 59223074 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [(1R,5R,6S)-5,6-diacetyloxy-3-(propylcarbamoyl)cyclohex-3-en-1-yl] acetate |
| SMILES | CCCNC(=O)C1=C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C16H23NO7/c1-5-6-17-16(21)12-7-13(22-9(2)18)15(24-11(4)20)14(8-12)23-10(3)19/h7,13-15H,5-6,8H2,1-4H3,(H,17,21)/t13-,14-,15-/m1/s1 |
| InChIKey | SGDCDQBXHZJPHZ-RBSFLKMASA-N |
| XLogP | 0.64 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|