C26H37N3O6 — CID 59223122
(2S,6R,9R,12R,13S)-12-benzyl-9-ethyl-13-hydroxy-6-methyl-2-[(E)-pent-1-enyl]-1-oxa-5,8,11-triazacyclopentadecane-4,7,10,15-tetrone (PubChem CID 59223122) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2S,6R,9R,12R,13S)-12-benzyl-9-ethyl-13-hydroxy-6-methyl-2-[(E)-pent-1-enyl]-1-oxa-5,8,11-triazacyclopentadecane-4,7,10,15-tetrone.
| Compound Name | (2S,6R,9R,12R,13S)-12-benzyl-9-ethyl-13-hydroxy-6-methyl-2-[(E)-pent-1-enyl]-1-oxa-5,8,11-triazacyclopentadecane-4,7,10,15-tetrone |
|---|---|
| PubChem CID | 59223122 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | (2S,6R,9R,12R,13S)-12-benzyl-9-ethyl-13-hydroxy-6-methyl-2-[(E)-pent-1-enyl]-1-oxa-5,8,11-triazacyclopentadecane-4,7,10,15-tetrone |
| SMILES | CCC/C=C/[C@@H]1CC(=O)N[C@H](C)C(=O)N[C@H](CC)C(=O)N[C@H](Cc2ccccc2)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C26H37N3O6/c1-4-6-8-13-19-15-23(31)27-17(3)25(33)28-20(5-2)26(34)29-21(22(30)16-24(32)35-19)14-18-11-9-7-10-12-18/h7-13,17,19-22,30H,4-6,14-16H2,1-3H3,(H,27,31)(H,28,33)(H,29,34)/b13-8+/t17-,19-,20-,21-,22+/m1/s1 |
| InChIKey | DBXMXQZODBTILT-GHYMQXDXSA-N |
| XLogP | 1.54 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|