About 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane
2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane (PubChem CID 59223647) has the molecular formula C9H17F3O2
and a molecular weight of 214.23 g/mol. Its IUPAC name is 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane.
Molecular Properties
| Compound Name | 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane |
| PubChem CID | 59223647 |
| Molecular Formula | C9H17F3O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane |
| SMILES | CCOC[C@@H](OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H17F3O2/c1-5-13-6-7(9(10,11)12)14-8(2,3)4/h7H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | FPWZQDJYBSDWCB-SSDOTTSWSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane?
The IUPAC name of 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane (CID 59223647) is 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane.
What is the SMILES notation for 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane?
The canonical SMILES for 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane is CCOC[C@@H](OC(C)(C)C)C(F)(F)F.
What is the InChIKey of 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane?
The InChIKey is FPWZQDJYBSDWCB-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H17F3O2/c1-5-13-6-7(9(10,11)12)14-8(2,3)4/h7H,5-6H2,1-4H3/t7-/m1/s1.
What are the key properties of 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane?
2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane has a molecular weight of 214.23 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-3-ethoxy-1,1,1-trifluoropropan-2-yl]oxy-2-methylpropane is sourced from PubChem (CID 59223647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).