About 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane
2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane (PubChem CID 59223653) has the molecular formula C10H19F3O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane.
Molecular Properties
| Compound Name | 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane |
| PubChem CID | 59223653 |
| Molecular Formula | C10H19F3O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane |
| SMILES | COCCOC[C@@H](OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H19F3O3/c1-9(2,3)16-8(10(11,12)13)7-15-6-5-14-4/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | AUPUDKNMNBKGSD-MRVPVSSYSA-N |
| XLogP | 2.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane?
The IUPAC name of 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane (CID 59223653) is 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane.
What is the SMILES notation for 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane?
The canonical SMILES for 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane is COCCOC[C@@H](OC(C)(C)C)C(F)(F)F.
What is the InChIKey of 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane?
The InChIKey is AUPUDKNMNBKGSD-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H19F3O3/c1-9(2,3)16-8(10(11,12)13)7-15-6-5-14-4/h8H,5-7H2,1-4H3/t8-/m1/s1.
What are the key properties of 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane?
2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane has a molecular weight of 244.25 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(2R)-1,1,1-trifluoro-3-(2-methoxyethoxy)propan-2-yl]oxypropane is sourced from PubChem (CID 59223653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).