C8H6F2O4 — CID 59224129
4-(difluoromethoxy)-3-hydroxybenzoic acid (PubChem CID 59224129) has the molecular formula C8H6F2O4 and a molecular weight of 204.13 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-hydroxybenzoic acid.
| Compound Name | 4-(difluoromethoxy)-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 59224129 |
| Molecular Formula | C8H6F2O4 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 4-(difluoromethoxy)-3-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(OC(F)F)c(O)c1 |
| InChI | InChI=1S/C8H6F2O4/c9-8(10)14-6-2-1-4(7(12)13)3-5(6)11/h1-3,8,11H,(H,12,13) |
| InChIKey | BWKXOOXYCKHVMK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |