About N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide
N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide (PubChem CID 59224571) has the molecular formula C19H31NO4
and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide.
Molecular Properties
| Compound Name | N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide |
| PubChem CID | 59224571 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide |
| SMILES | CC[C@@H](C)N(CC(OC)OC)C(=O)CCOCCc1ccccc1 |
| InChI | InChI=1S/C19H31NO4/c1-5-16(2)20(15-19(22-3)23-4)18(21)12-14-24-13-11-17-9-7-6-8-10-17/h6-10,16,19H,5,11-15H2,1-4H3/t16-/m1/s1 |
| InChIKey | QYNGORAOOYKSOJ-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide?
The IUPAC name of N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide (CID 59224571) is N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide.
What is the SMILES notation for N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide?
The canonical SMILES for N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide is CC[C@@H](C)N(CC(OC)OC)C(=O)CCOCCc1ccccc1.
What is the InChIKey of N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide?
The InChIKey is QYNGORAOOYKSOJ-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H31NO4/c1-5-16(2)20(15-19(22-3)23-4)18(21)12-14-24-13-11-17-9-7-6-8-10-17/h6-10,16,19H,5,11-15H2,1-4H3/t16-/m1/s1.
What are the key properties of N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide?
N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide has a molecular weight of 337.46 g/mol, XLogP of 2.88, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-butan-2-yl]-N-(2,2-dimethoxyethyl)-3-(2-phenylethoxy)propanamide is sourced from PubChem (CID 59224571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).