C28H22N4O3 — CID 59224742
2-[2-(2-methyl-1,3-dihydroisoindol-5-yl)indolizin-3-yl]-N-[4-(1,3-oxazol-2-yl)phenyl]-2-oxoacetamide (PubChem CID 59224742) has the molecular formula C28H22N4O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-[2-(2-methyl-1,3-dihydroisoindol-5-yl)indolizin-3-yl]-N-[4-(1,3-oxazol-2-yl)phenyl]-2-oxoacetamide.
| Compound Name | 2-[2-(2-methyl-1,3-dihydroisoindol-5-yl)indolizin-3-yl]-N-[4-(1,3-oxazol-2-yl)phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 59224742 |
| Molecular Formula | C28H22N4O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[2-(2-methyl-1,3-dihydroisoindol-5-yl)indolizin-3-yl]-N-[4-(1,3-oxazol-2-yl)phenyl]-2-oxoacetamide |
| SMILES | CN1Cc2ccc(-c3cc4ccccn4c3C(=O)C(=O)Nc3ccc(-c4ncco4)cc3)cc2C1 |
| InChI | InChI=1S/C28H22N4O3/c1-31-16-20-6-5-19(14-21(20)17-31)24-15-23-4-2-3-12-32(23)25(24)26(33)27(34)30-22-9-7-18(8-10-22)28-29-11-13-35-28/h2-15H,16-17H2,1H3,(H,30,34) |
| InChIKey | VRHUKEHSRDBXLP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|