C9H10N4 — CID 59226006
9-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene (PubChem CID 59226006) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 9-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene.
| Compound Name | 9-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene |
|---|---|
| PubChem CID | 59226006 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 9-methyl-4,7,8,12-tetrazatricyclo[6.4.0.02,6]dodeca-1,6,9,11-tetraene |
| SMILES | Cc1ccnc2c3c(nn12)CNC3 |
| InChI | InChI=1S/C9H10N4/c1-6-2-3-11-9-7-4-10-5-8(7)12-13(6)9/h2-3,10H,4-5H2,1H3 |
| InChIKey | RJIRGTCDRIUHBQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |