C31H30F3N2O3+ — CID 59226155
diphenyl-[5-[[(3R)-3-[3-(trifluoromethyl)phenoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol (PubChem CID 59226155) has the molecular formula C31H30F3N2O3+ and a molecular weight of 535.59 g/mol. Its IUPAC name is diphenyl-[5-[[(3R)-3-[3-(trifluoromethyl)phenoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol.
| Compound Name | diphenyl-[5-[[(3R)-3-[3-(trifluoromethyl)phenoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 59226155 |
| Molecular Formula | C31H30F3N2O3+ |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | diphenyl-[5-[[(3R)-3-[3-(trifluoromethyl)phenoxy]-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1ncc(C[N+]23CCC(CC2)[C@@H](Oc2cccc(C(F)(F)F)c2)C3)o1 |
| InChI | InChI=1S/C31H30F3N2O3/c32-31(33,34)25-12-7-13-26(18-25)38-28-21-36(16-14-22(28)15-17-36)20-27-19-35-29(39-27)30(37,23-8-3-1-4-9-23)24-10-5-2-6-11-24/h1-13,18-19,22,28,37H,14-17,20-21H2/q+1/t22?,28-,36?/m0/s1 |
| InChIKey | HINPHWGXFAKZPP-RLKDHKGHSA-N |
| XLogP | 6.17 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|