C24H33N2O2+ — CID 59226191
(S)-[5-(1-azoniabicyclo[2.2.2]octan-1-ylmethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol (PubChem CID 59226191) has the molecular formula C24H33N2O2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is (S)-[5-(1-azoniabicyclo[2.2.2]octan-1-ylmethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol.
| Compound Name | (S)-[5-(1-azoniabicyclo[2.2.2]octan-1-ylmethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol |
|---|---|
| PubChem CID | 59226191 |
| Molecular Formula | C24H33N2O2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | (S)-[5-(1-azoniabicyclo[2.2.2]octan-1-ylmethyl)-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanol |
| SMILES | O[C@@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)CC3)o1)C1CCCCC1 |
| InChI | InChI=1S/C24H33N2O2/c27-24(20-7-3-1-4-8-20,21-9-5-2-6-10-21)23-25-17-22(28-23)18-26-14-11-19(12-15-26)13-16-26/h1,3-4,7-8,17,19,21,27H,2,5-6,9-16,18H2/q+1/t19?,24-,26?/m1/s1 |
| InChIKey | DPDAXKYCBUQEJT-KBXRBSQXSA-N |
| XLogP | 4.62 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|