C24H23F3N4O3 — CID 59226384
3-amino-6-(2,6-difluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-5-methylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide (PubChem CID 59226384) has the molecular formula C24H23F3N4O3 and a molecular weight of 472.47 g/mol. Its IUPAC name is 3-amino-6-(2,6-difluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-5-methylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | 3-amino-6-(2,6-difluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-5-methylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 59226384 |
| Molecular Formula | C24H23F3N4O3 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 3-amino-6-(2,6-difluorophenyl)-N-[4-[(1R,3R,4R,5S)-3,4-dihydroxy-5-methylcyclohexyl]-3-pyridinyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2nc(-c3c(F)cccc3F)c(F)cc2N)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H23F3N4O3/c1-11-7-12(8-19(32)23(11)33)13-5-6-29-10-18(13)30-24(34)22-17(28)9-16(27)21(31-22)20-14(25)3-2-4-15(20)26/h2-6,9-12,19,23,32-33H,7-8,28H2,1H3,(H,30,34)/t11-,12+,19+,23+/m0/s1 |
| InChIKey | TXAQYFMSBSSETH-LZJPNDHISA-N |
| XLogP | 3.63 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |