C15H27N — CID 592267
2,6-bis(pent-4-enyl)piperidine (PubChem CID 592267) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2,6-bis(pent-4-enyl)piperidine.
| Compound Name | 2,6-bis(pent-4-enyl)piperidine |
|---|---|
| PubChem CID | 592267 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2,6-bis(pent-4-enyl)piperidine |
| SMILES | C=CCCCC1CCCC(CCCC=C)N1 |
| InChI | InChI=1S/C15H27N/c1-3-5-7-10-14-12-9-13-15(16-14)11-8-6-4-2/h3-4,14-16H,1-2,5-13H2 |
| InChIKey | AFBIHOXBWUXQRS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|