C44H49NO8 — CID 59226810
(2R,3S,4S)-5-hydroxy-N-methoxy-N-methyl-2,3,4,6-tetrakis(phenylmethoxy)-5-(phenylmethoxymethyl)hexanamide (PubChem CID 59226810) has the molecular formula C44H49NO8 and a molecular weight of 719.88 g/mol. Its IUPAC name is (2R,3S,4S)-5-hydroxy-N-methoxy-N-methyl-2,3,4,6-tetrakis(phenylmethoxy)-5-(phenylmethoxymethyl)hexanamide.
| Compound Name | (2R,3S,4S)-5-hydroxy-N-methoxy-N-methyl-2,3,4,6-tetrakis(phenylmethoxy)-5-(phenylmethoxymethyl)hexanamide |
|---|---|
| PubChem CID | 59226810 |
| Molecular Formula | C44H49NO8 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.35 |
| IUPAC Name | (2R,3S,4S)-5-hydroxy-N-methoxy-N-methyl-2,3,4,6-tetrakis(phenylmethoxy)-5-(phenylmethoxymethyl)hexanamide |
| SMILES | CON(C)C(=O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(O)(COCc1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C44H49NO8/c1-45(48-2)43(46)41(52-31-38-24-14-6-15-25-38)40(51-30-37-22-12-5-13-23-37)42(53-32-39-26-16-7-17-27-39)44(47,33-49-28-35-18-8-3-9-19-35)34-50-29-36-20-10-4-11-21-36/h3-27,40-42,47H,28-34H2,1-2H3/t40-,41-,42+/m1/s1 |
| InChIKey | BIGIYLDERIRBNT-UJYRSYRGSA-N |
| XLogP | 6.93 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|