C15H28O2 — CID 59226844
(3S,4S,5R)-2,2-diethyl-3,4,5-trimethyl-6-prop-2-enoxyoxane (PubChem CID 59226844) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (3S,4S,5R)-2,2-diethyl-3,4,5-trimethyl-6-prop-2-enoxyoxane.
| Compound Name | (3S,4S,5R)-2,2-diethyl-3,4,5-trimethyl-6-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 59226844 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (3S,4S,5R)-2,2-diethyl-3,4,5-trimethyl-6-prop-2-enoxyoxane |
| SMILES | C=CCOC1OC(CC)(CC)[C@@H](C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C15H28O2/c1-7-10-16-14-12(5)11(4)13(6)15(8-2,9-3)17-14/h7,11-14H,1,8-10H2,2-6H3/t11-,12-,13+,14?/m1/s1 |
| InChIKey | HAQOEQYWWXSFHX-HABKJSAYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|