C11H18O8S — CID 59227127
ethyl (4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 59227127) has the molecular formula C11H18O8S and a molecular weight of 310.32 g/mol. Its IUPAC name is ethyl (4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | ethyl (4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 59227127 |
| Molecular Formula | C11H18O8S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethyl (4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)OS(=O)(=O)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H18O8S/c1-5-15-9(12)11(4)8(18-20(13,14)19-11)7-6-16-10(2,3)17-7/h7-8H,5-6H2,1-4H3/t7-,8-,11+/m1/s1 |
| InChIKey | UYMLTUZYEYHYHO-XLDPMVHQSA-N |
| XLogP | 0.12 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |