C11H18FO8S- — CID 59227129
[(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2-fluoro-2-methyl-3-oxopropyl] sulfate (PubChem CID 59227129) has the molecular formula C11H18FO8S- and a molecular weight of 329.32 g/mol. Its IUPAC name is [(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2-fluoro-2-methyl-3-oxopropyl] sulfate.
| Compound Name | [(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2-fluoro-2-methyl-3-oxopropyl] sulfate |
|---|---|
| PubChem CID | 59227129 |
| Molecular Formula | C11H18FO8S- |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [(1R,2R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-ethoxy-2-fluoro-2-methyl-3-oxopropyl] sulfate |
| SMILES | CCOC(=O)[C@](C)(F)[C@H](OS(=O)(=O)[O-])[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H19FO8S/c1-5-17-9(13)11(4,12)8(20-21(14,15)16)7-6-18-10(2,3)19-7/h7-8H,5-6H2,1-4H3,(H,14,15,16)/p-1/t7-,8-,11-/m1/s1 |
| InChIKey | XRFULEACXKRTDI-SOCHQFKDSA-M |
| XLogP | 0.27 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|