C11H19FO8S — CID 59227133
ethyl (2R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-sulfooxypropanoate (PubChem CID 59227133) has the molecular formula C11H19FO8S and a molecular weight of 330.33 g/mol. Its IUPAC name is ethyl (2R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-sulfooxypropanoate.
| Compound Name | ethyl (2R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-sulfooxypropanoate |
|---|---|
| PubChem CID | 59227133 |
| Molecular Formula | C11H19FO8S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | ethyl (2R)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-fluoro-2-methyl-3-sulfooxypropanoate |
| SMILES | CCOC(=O)[C@](C)(F)C(OS(=O)(=O)O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H19FO8S/c1-5-17-9(13)11(4,12)8(20-21(14,15)16)7-6-18-10(2,3)19-7/h7-8H,5-6H2,1-4H3,(H,14,15,16)/t7-,8?,11-/m1/s1 |
| InChIKey | XRFULEACXKRTDI-RBTFRQDQSA-N |
| XLogP | 0.62 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|