C8H9NO3 — CID 59227363
N,3-dimethyl-4-oxopyran-2-carboxamide (PubChem CID 59227363) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is N,3-dimethyl-4-oxopyran-2-carboxamide.
| Compound Name | N,3-dimethyl-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 59227363 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | N,3-dimethyl-4-oxopyran-2-carboxamide |
| SMILES | CNC(=O)c1occc(=O)c1C |
| InChI | InChI=1S/C8H9NO3/c1-5-6(10)3-4-12-7(5)8(11)9-2/h3-4H,1-2H3,(H,9,11) |
| InChIKey | JJDNBCBPQWCFDM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |