C15H21NO6Si — CID 59227492
(3aS,7aR)-7a-methyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydro-3aH-2-benzofuran-1,3-dione (PubChem CID 59227492) has the molecular formula C15H21NO6Si and a molecular weight of 339.42 g/mol. Its IUPAC name is (3aS,7aR)-7a-methyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | (3aS,7aR)-7a-methyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 59227492 |
| Molecular Formula | C15H21NO6Si |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3aS,7aR)-7a-methyl-5-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)-4,7-dihydro-3aH-2-benzofuran-1,3-dione |
| SMILES | C[C@@]12CC=C([Si]34OCCN(CCO3)CCO4)C[C@@H]1C(=O)OC2=O |
| InChI | InChI=1S/C15H21NO6Si/c1-15-3-2-11(10-12(15)13(17)22-14(15)18)23-19-7-4-16(5-8-20-23)6-9-21-23/h2,12H,3-10H2,1H3/t12-,15-/m1/s1 |
| InChIKey | FJQWWFSGCYBMJK-IUODEOHRSA-N |
| XLogP | 0.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|