C29H18Cl8N2 — CID 59227527
2-N,4-N-bis[2,6-dichloro-4-(2,6-dichlorophenyl)phenyl]pentane-2,4-diimine (PubChem CID 59227527) has the molecular formula C29H18Cl8N2 and a molecular weight of 678.10 g/mol. Its IUPAC name is 2-N,4-N-bis[2,6-dichloro-4-(2,6-dichlorophenyl)phenyl]pentane-2,4-diimine.
| Compound Name | 2-N,4-N-bis[2,6-dichloro-4-(2,6-dichlorophenyl)phenyl]pentane-2,4-diimine |
|---|---|
| PubChem CID | 59227527 |
| Molecular Formula | C29H18Cl8N2 |
| Molecular Weight | 678.10 g/mol |
| Exact Mass | 673.90 |
| IUPAC Name | 2-N,4-N-bis[2,6-dichloro-4-(2,6-dichlorophenyl)phenyl]pentane-2,4-diimine |
| SMILES | C/C(C/C(C)=N/c1c(Cl)cc(-c2c(Cl)cccc2Cl)cc1Cl)=N\c1c(Cl)cc(-c2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C29H18Cl8N2/c1-14(38-28-22(34)10-16(11-23(28)35)26-18(30)5-3-6-19(26)31)9-15(2)39-29-24(36)12-17(13-25(29)37)27-20(32)7-4-8-21(27)33/h3-8,10-13H,9H2,1-2H3/b38-14+,39-15+ |
| InChIKey | UDBJZRDAPUJCDX-QGZAGHSOSA-N |
| XLogP | 13.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.10 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|