C37H30F3NO2 — CID 59227591
4-[5-(4-methoxyphenyl)-10-(trifluoromethyl)-6-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl]-N,N-dimethylaniline (PubChem CID 59227591) has the molecular formula C37H30F3NO2 and a molecular weight of 577.65 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-10-(trifluoromethyl)-6-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-(4-methoxyphenyl)-10-(trifluoromethyl)-6-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59227591 |
| Molecular Formula | C37H30F3NO2 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-10-(trifluoromethyl)-6-oxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl]-N,N-dimethylaniline |
| SMILES | COc1ccc(C2(c3ccc(N(C)C)cc3)C=Cc3c4c(c5ccc(C(F)(F)F)cc5c3O2)-c2ccccc2CC4)cc1 |
| InChI | InChI=1S/C37H30F3NO2/c1-41(2)27-14-9-24(10-15-27)36(25-11-16-28(42-3)17-12-25)21-20-32-30-18-8-23-6-4-5-7-29(23)34(30)31-19-13-26(37(38,39)40)22-33(31)35(32)43-36/h4-7,9-17,19-22H,8,18H2,1-3H3 |
| InChIKey | DWDGTOUZVFVZMN-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|