About (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate
(1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate (PubChem CID 59228644) has the molecular formula C18H24N2O7Si
and a molecular weight of 408.48 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate |
| PubChem CID | 59228644 |
| Molecular Formula | C18H24N2O7Si |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate |
| SMILES | CCO[Si](OCC)(OCC)C1CCN1C(=O)ON1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H24N2O7Si/c1-4-24-28(25-5-2,26-6-3)15-11-12-19(15)18(23)27-20-16(21)13-9-7-8-10-14(13)17(20)22/h7-10,15H,4-6,11-12H2,1-3H3 |
| InChIKey | QNJOAOVAQYRTEM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate (CID 59228644) is (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate is CCO[Si](OCC)(OCC)C1CCN1C(=O)ON1C(=O)c2ccccc2C1=O.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate?
The InChIKey is QNJOAOVAQYRTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O7Si/c1-4-24-28(25-5-2,26-6-3)15-11-12-19(15)18(23)27-20-16(21)13-9-7-8-10-14(13)17(20)22/h7-10,15H,4-6,11-12H2,1-3H3.
What are the key properties of (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate?
(1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate has a molecular weight of 408.48 g/mol, XLogP of 2.00, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) 2-triethoxysilylazetidine-1-carboxylate is sourced from PubChem (CID 59228644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).