C16H18O4 — CID 59229031
5-[(4-ethenylphenyl)methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione (PubChem CID 59229031) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 5-[(4-ethenylphenyl)methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-ethenylphenyl)methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 59229031 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 5-[(4-ethenylphenyl)methyl]-2,2,5-trimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=Cc1ccc(CC2(C)C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C16H18O4/c1-5-11-6-8-12(9-7-11)10-16(4)13(17)19-15(2,3)20-14(16)18/h5-9H,1,10H2,2-4H3 |
| InChIKey | WRGXYNOXYIBSIK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|