C22H26F2N4O6 — CID 59229103
2,3-difluoro-5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione (PubChem CID 59229103) has the molecular formula C22H26F2N4O6 and a molecular weight of 480.47 g/mol. Its IUPAC name is 2,3-difluoro-5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | 2,3-difluoro-5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 59229103 |
| Molecular Formula | C22H26F2N4O6 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2,3-difluoro-5,8-dihydroxy-1,4-bis[2-(2-hydroxyethylamino)ethylamino]anthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(O)c2C(=O)c2c(NCCNCCO)c(F)c(F)c(NCCNCCO)c21 |
| InChI | InChI=1S/C22H26F2N4O6/c23-17-18(24)20(28-6-4-26-8-10-30)16-15(19(17)27-5-3-25-7-9-29)21(33)13-11(31)1-2-12(32)14(13)22(16)34/h1-2,25-32H,3-10H2 |
| InChIKey | DKEFKKHQHZSDOZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|