C16H30O2 — CID 59229163
4-ethoxy-5,6-dimethyl-3-(3-methylpentyl)cyclohex-2-en-1-ol (PubChem CID 59229163) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 4-ethoxy-5,6-dimethyl-3-(3-methylpentyl)cyclohex-2-en-1-ol.
| Compound Name | 4-ethoxy-5,6-dimethyl-3-(3-methylpentyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 59229163 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 4-ethoxy-5,6-dimethyl-3-(3-methylpentyl)cyclohex-2-en-1-ol |
| SMILES | CCOC1C(CCC(C)CC)=CC(O)C(C)C1C |
| InChI | InChI=1S/C16H30O2/c1-6-11(3)8-9-14-10-15(17)12(4)13(5)16(14)18-7-2/h10-13,15-17H,6-9H2,1-5H3 |
| InChIKey | VCJPKFLGBOFQPK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|