C29H55O3- — CID 59229198
4-ethoxy-3-(11-hydroxy-3,7,11-trimethylhexadecyl)-5,6-dimethylcyclohex-2-en-1-ol (PubChem CID 59229198) has the molecular formula C29H55O3- and a molecular weight of 451.76 g/mol. Its IUPAC name is 4-ethoxy-3-(11-hydroxy-3,7,11-trimethylhexadecyl)-5,6-dimethylcyclohex-2-en-1-ol.
| Compound Name | 4-ethoxy-3-(11-hydroxy-3,7,11-trimethylhexadecyl)-5,6-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 59229198 |
| Molecular Formula | C29H55O3- |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.42 |
| IUPAC Name | 4-ethoxy-3-(11-hydroxy-3,7,11-trimethylhexadecyl)-5,6-dimethylcyclohex-2-en-1-ol |
| SMILES | C[CH-]CCCC(C)(O)CCCC(C)CCCC(C)CCC1=CC(O)C(C)C(C)C1OCC |
| InChI | InChI=1S/C29H55O3/c1-8-10-11-19-29(7,31)20-13-16-22(3)14-12-15-23(4)17-18-26-21-27(30)24(5)25(6)28(26)32-9-2/h8,21-25,27-28,30-31H,9-20H2,1-7H3/q-1 |
| InChIKey | PXPHXPXUSVKQKX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|