C31H57O2- — CID 59229217
4-butoxy-5,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-7-enyl]cyclohex-2-en-1-ol (PubChem CID 59229217) has the molecular formula C31H57O2- and a molecular weight of 461.80 g/mol. Its IUPAC name is 4-butoxy-5,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-7-enyl]cyclohex-2-en-1-ol.
| Compound Name | 4-butoxy-5,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-7-enyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 59229217 |
| Molecular Formula | C31H57O2- |
| Molecular Weight | 461.80 g/mol |
| Exact Mass | 461.44 |
| IUPAC Name | 4-butoxy-5,6-dimethyl-3-[(E)-3,7,11-trimethylhexadec-7-enyl]cyclohex-2-en-1-ol |
| SMILES | C[CH-]CCCC(C)CC/C=C(\C)CCCC(C)CCC1=CC(O)C(C)C(C)C1OCCCC |
| InChI | InChI=1S/C31H57O2/c1-8-10-12-15-24(3)16-13-17-25(4)18-14-19-26(5)20-21-29-23-30(32)27(6)28(7)31(29)33-22-11-9-2/h8,17,23-24,26-28,30-32H,9-16,18-22H2,1-7H3/q-1/b25-17+ |
| InChIKey | ZUWVWLHEYJYXLP-KOEQRZSOSA-N |
| XLogP | 9.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.80 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|