C27H50O — CID 59229232
1-(3,7-dimethylnonyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene (PubChem CID 59229232) has the molecular formula C27H50O and a molecular weight of 390.70 g/mol. Its IUPAC name is 1-(3,7-dimethylnonyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene.
| Compound Name | 1-(3,7-dimethylnonyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 59229232 |
| Molecular Formula | C27H50O |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.39 |
| IUPAC Name | 1-(3,7-dimethylnonyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene |
| SMILES | CCCCCCCCOC1C(CCC(C)CCCC(C)CC)=CC=C(C)C1C |
| InChI | InChI=1S/C27H50O/c1-7-9-10-11-12-13-21-28-27-25(6)24(5)18-20-26(27)19-17-23(4)16-14-15-22(3)8-2/h18,20,22-23,25,27H,7-17,19,21H2,1-6H3 |
| InChIKey | PPRGNBIJUJVZQX-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|