About (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate
(E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate (PubChem CID 59229241) has the molecular formula C16H29O3-
and a molecular weight of 269.40 g/mol. Its IUPAC name is (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate.
Molecular Properties
| Compound Name | (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate |
| PubChem CID | 59229241 |
| Molecular Formula | C16H29O3- |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate |
| SMILES | CC/C=C(\C)CCCC(C)(O)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C16H30O3/c1-5-8-13(2)9-6-11-16(4,19)12-7-10-14(3)15(17)18/h8,14,19H,5-7,9-12H2,1-4H3,(H,17,18)/p-1/b13-8+ |
| InChIKey | KRVMWWIJAGGGAD-MDWZMJQESA-M |
| XLogP | 2.82 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate?
The IUPAC name of (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate (CID 59229241) is (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate.
What is the SMILES notation for (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate?
The canonical SMILES for (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate is CC/C=C(\C)CCCC(C)(O)CCCC(C)C(=O)[O-].
What is the InChIKey of (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate?
The InChIKey is KRVMWWIJAGGGAD-MDWZMJQESA-M. The full InChI is InChI=1S/C16H30O3/c1-5-8-13(2)9-6-11-16(4,19)12-7-10-14(3)15(17)18/h8,14,19H,5-7,9-12H2,1-4H3,(H,17,18)/p-1/b13-8+.
What are the key properties of (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate?
(E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate has a molecular weight of 269.40 g/mol, XLogP of 2.82, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-hydroxy-2,6,10-trimethyltridec-10-enoate is sourced from PubChem (CID 59229241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).