C26H46O — CID 59229247
1-(3,7-dimethyloct-6-enyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene (PubChem CID 59229247) has the molecular formula C26H46O and a molecular weight of 374.65 g/mol. Its IUPAC name is 1-(3,7-dimethyloct-6-enyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene.
| Compound Name | 1-(3,7-dimethyloct-6-enyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 59229247 |
| Molecular Formula | C26H46O |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 374.35 |
| IUPAC Name | 1-(3,7-dimethyloct-6-enyl)-4,5-dimethyl-6-octoxycyclohexa-1,3-diene |
| SMILES | CCCCCCCCOC1C(CCC(C)CCC=C(C)C)=CC=C(C)C1C |
| InChI | InChI=1S/C26H46O/c1-7-8-9-10-11-12-20-27-26-24(6)23(5)17-19-25(26)18-16-22(4)15-13-14-21(2)3/h14,17,19,22,24,26H,7-13,15-16,18,20H2,1-6H3 |
| InChIKey | KHAWQRDJDLAYPF-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|