C32H55O3- — CID 59229276
(E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate (PubChem CID 59229276) has the molecular formula C32H55O3- and a molecular weight of 487.79 g/mol. Its IUPAC name is (E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate.
| Compound Name | (E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate |
|---|---|
| PubChem CID | 59229276 |
| Molecular Formula | C32H55O3- |
| Molecular Weight | 487.79 g/mol |
| Exact Mass | 487.42 |
| IUPAC Name | (E)-16-(6-butoxy-4,5-dimethylcyclohexa-1,3-dien-1-yl)-2,6,10,14-tetramethylhexadec-9-enoate |
| SMILES | CCCCOC1C(CCC(C)CCC/C(C)=C/CCC(C)CCCC(C)C(=O)[O-])=CC=C(C)C1C |
| InChI | InChI=1S/C32H56O3/c1-8-9-23-35-31-29(7)27(5)20-22-30(31)21-19-26(4)16-11-15-24(2)13-10-14-25(3)17-12-18-28(6)32(33)34/h13,20,22,25-26,28-29,31H,8-12,14-19,21,23H2,1-7H3,(H,33,34)/p-1/b24-13+ |
| InChIKey | INIIJJKKMNEVCQ-ZMOGYAJESA-M |
| XLogP | 8.20 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.79 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|