C35H62O — CID 59229280
1,6-dimethyl-5-octoxy-4-[(6E,10E)-3,7,11-trimethylhexadeca-6,10-dienyl]cyclohexa-1,3-diene (PubChem CID 59229280) has the molecular formula C35H62O and a molecular weight of 498.88 g/mol. Its IUPAC name is 1,6-dimethyl-5-octoxy-4-[(6E,10E)-3,7,11-trimethylhexadeca-6,10-dienyl]cyclohexa-1,3-diene.
| Compound Name | 1,6-dimethyl-5-octoxy-4-[(6E,10E)-3,7,11-trimethylhexadeca-6,10-dienyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 59229280 |
| Molecular Formula | C35H62O |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.48 |
| IUPAC Name | 1,6-dimethyl-5-octoxy-4-[(6E,10E)-3,7,11-trimethylhexadeca-6,10-dienyl]cyclohexa-1,3-diene |
| SMILES | CCCCCCCCOC1C(CCC(C)CC/C=C(\C)CC/C=C(\C)CCCCC)=CC=C(C)C1C |
| InChI | InChI=1S/C35H62O/c1-8-10-12-13-14-16-28-36-35-33(7)32(6)25-27-34(35)26-24-31(5)23-18-22-30(4)21-17-20-29(3)19-15-11-9-2/h20,22,25,27,31,33,35H,8-19,21,23-24,26,28H2,1-7H3/b29-20+,30-22+ |
| InChIKey | WGQMOBOECYQJOC-KMEIOBGGSA-N |
| XLogP | 11.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|